Urea
This page lists Urea compounds supplied by FireTard: 15,645 products in total, each identified by its CAS Registry Number. Examples include Urea, N-[(2-chlorophenyl)methyl]-N'-(4-methylphenyl)- (CAS 138111-35-0), Urea,N,N-dimethyl-N'-[3-[1-[[(tetrahydro-2H-pyran-2-yl)oxy]imino]ethyl]phenyl]- (CAS 115972-65-1), Urea, N-(2-chloro-3-pyridinyl)-N'-phenyl- (CAS 61964-07-6), 1-nitroso-1-(2-hydroxyethyl)-3-ethylurea (CAS 96724-45-7), Urea, [2-(phenylmethoxy)-5-(2-pyridinylcarbonyl)phenyl]- (CAS 58283-15-1). Open a product page for its molecular formula, identifiers and synonyms, or send an inquiry for purity, packaging, price and lead time.
| CAS Number | Chemical Name | Catalog No. |
|---|---|---|
| 138111-35-0 | Urea, N-[(2-chlorophenyl)methyl]-N'-(4-methylphenyl)- | 380388 |
| 115972-65-1 | Urea,N,N-dimethyl-N'-[3-[1-[[(tetrahydro-2H-pyran-2-yl)oxy]imino]ethyl]phenyl]- | 380663 |
| 61964-07-6 | Urea, N-(2-chloro-3-pyridinyl)-N'-phenyl- | 381669 |
| 96724-45-7 | 1-nitroso-1-(2-hydroxyethyl)-3-ethylurea | 381962 |
| 58283-15-1 | Urea, [2-(phenylmethoxy)-5-(2-pyridinylcarbonyl)phenyl]- | 382106 |
| 95760-84-2 | Urea, N-(4-nitrophenoxy)-N'-phenyl- | 382574 |
| 89721-75-5 | Urea, N-[4-(1,2-benzisothiazol-5-yloxy)phenyl]-N'-methyl- | 382807 |
| 89721-77-7 | Urea, N'-[4-(1,2-benzisothiazol-5-yloxy)phenyl]-N,N-dimethoxy- | 382808 |
| 89721-81-3 | Urea, N'-[4-(1,2-benzisothiazol-5-yloxy)phenyl]-N,N-bis(1-methylethyl)- | 382809 |
| 65758-38-5 | Urea, [(2,4-dihydroxyphenyl)methyl]- | 383018 |
| 178699-05-3 | Urea, N,N''-(methylenedi-4,1-phenylene)bis[N'-(9Z)-9-octadecenyl- | 383534 |
| 63719-41-5 | Urea, N'-[(8a)-2-chloro-6-methylergolin-8-yl]-N,N-diethyl- | 383783 |