Urea
This page lists Urea compounds supplied by FireTard: 15,645 products in total, each identified by its CAS Registry Number. Examples include Urea, N-[4-(dimethylamino)phenyl]-N'-[2-(hydroxymethyl)phenyl]- (CAS 85707-94-4), Urea,N-[4-(diethylamino)phenyl]-N'-[2-hydroxy-1-(hydroxymethyl)-1-methylethyl]- (CAS 85707-97-7), Urea, N'-[4-(diethylamino)phenyl]-N,N-bis(2-hydroxyethyl)- (CAS 85707-99-9), 3-(1-ethoxycyclopropyl)-1,1-dimethylurea (CAS 64833-45-0), 1-(4,6-dimethylpyrimidin-2-yl)urea - 1,3,5-triazine-2,4,6-triamine (1:1) (CAS 114636-21-4). Open a product page for its molecular formula, identifiers and synonyms, or send an inquiry for purity, packaging, price and lead time.
| CAS Number | Chemical Name | Catalog No. |
|---|---|---|
| 85707-94-4 | Urea, N-[4-(dimethylamino)phenyl]-N'-[2-(hydroxymethyl)phenyl]- | 409084 |
| 85707-97-7 | Urea,N-[4-(diethylamino)phenyl]-N'-[2-hydroxy-1-(hydroxymethyl)-1-methylethyl]- | 409085 |
| 85707-99-9 | Urea, N'-[4-(diethylamino)phenyl]-N,N-bis(2-hydroxyethyl)- | 409086 |
| 64833-45-0 | 3-(1-ethoxycyclopropyl)-1,1-dimethylurea | 409446 |
| 114636-21-4 | 1-(4,6-dimethylpyrimidin-2-yl)urea - 1,3,5-triazine-2,4,6-triamine (1:1) | 409698 |
| 586416-29-7 | Urea, N-5-isoquinolinyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]- | 409833 |
| 58663-32-4 | Urea, [3-(2-aminopropyl)phenyl]- | 409869 |
| 124-45-8 | Calcium,dichlorotetrakis(urea-O)- (9CI) | 410406 |
| 74428-56-1 | 1-(9H-xanthen-9-yl)urea | 410529 |
| 197228-36-7 | Urea, N-(5-chloro-2-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]- | 411316 |
| 6376-69-8 | 1-(2,4-Dichlorophenyl)-3-[(2Z)-5-[(E)-2-phenylvinyl]-1,3,4-thiadiazol-2(3H)-ylidene]urea | 411438 |
| 6376-83-6 | 1-{5-[(2-Allylphenoxy)methyl]-1,3,4-thiadiazol-2-yl}-3-(4-fluorophenyl)urea | 411447 |