Urea
This page lists Urea compounds supplied by FireTard: 15,645 products in total, each identified by its CAS Registry Number. Examples include 1-(2-chloroethyl)-3-(2,6-dimethylmorpholin-4-yl)-1-nitrosourea (CAS 74532-83-5), N-(2-chloroethyl)-N-(2-(methylsulfonyl)ethyl)-N-nitrosourea (CAS 79955-36-5), 1-Butyl-3-metanilylurea (CAS 4618-41-1), Urea, N-(5-chloro-2-pyridinyl)-N'-phenyl- (CAS 10461-91-3), UREA, 1-METHYL-3-TRICYCLO[3.2.1.02,4]OCT-3-YL- (CAS 33779-14-5). Open a product page for its molecular formula, identifiers and synonyms, or send an inquiry for purity, packaging, price and lead time.
| CAS Number | Chemical Name | Catalog No. |
|---|---|---|
| 74532-83-5 | 1-(2-chloroethyl)-3-(2,6-dimethylmorpholin-4-yl)-1-nitrosourea | 459837 |
| 79955-36-5 | N-(2-chloroethyl)-N-(2-(methylsulfonyl)ethyl)-N-nitrosourea | 460410 |
| 4618-41-1 | 1-Butyl-3-metanilylurea | 460975 |
| 10461-91-3 | Urea, N-(5-chloro-2-pyridinyl)-N'-phenyl- | 461485 |
| 33779-14-5 | UREA, 1-METHYL-3-TRICYCLO[3.2.1.02,4]OCT-3-YL- | 461812 |
| 873773-50-3 | 1-(IMINO-PYRROLIDIN-1-YL-METHYL)-3-PHENYL-UREA HYDROCHLORIDE | 461992 |
| 634184-62-6 | Urea, N-[3,5-bis(trifluoromethyl)phenyl]-N'-(5-chloro-2-hydroxyphenyl)- | 462106 |
| 92949-91-2 | Urea, N-(4-amino-2-hydroxyphenyl)-N'-phenyl- | 462229 |
| 827309-08-0 | Urea,N-[2-(3,4-dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)ethyl]-N'-(diphenylmethyl)- | 462260 |
| 803729-75-1 | Urea, N-(2-chloroethyl)-N'-[3-(3-hydroxypropyl)phenyl]- | 462389 |
| 803729-86-4 | Urea, N-(2-chloroethyl)-N'-[3-(5-methoxypentyl)phenyl]- | 462390 |
| 803730-01-0 | Urea, N-(2-chloroethyl)-N'-(3-hexylphenyl)- | 462391 |